C22H21N3O4 — CID 86997125
N'-(4-ethyl-3-nitrophenyl)-N-(2-naphthalen-1-ylethyl)oxamide (PubChem CID 86997125) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is N'-(4-ethyl-3-nitrophenyl)-N-(2-naphthalen-1-ylethyl)oxamide.
| Compound Name | N'-(4-ethyl-3-nitrophenyl)-N-(2-naphthalen-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 86997125 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N'-(4-ethyl-3-nitrophenyl)-N-(2-naphthalen-1-ylethyl)oxamide |
| SMILES | CCc1ccc(NC(=O)C(=O)NCCc2cccc3ccccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H21N3O4/c1-2-15-10-11-18(14-20(15)25(28)29)24-22(27)21(26)23-13-12-17-8-5-7-16-6-3-4-9-19(16)17/h3-11,14H,2,12-13H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | CQRLOLHNKSXIFI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|