C16H17FN4O5 — CID 41454116
N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-N'-(4-fluoro-3-nitrophenyl)oxamide (PubChem CID 41454116) has the molecular formula C16H17FN4O5 and a molecular weight of 364.33 g/mol. Its IUPAC name is N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-N'-(4-fluoro-3-nitrophenyl)oxamide.
| Compound Name | N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-N'-(4-fluoro-3-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 41454116 |
| Molecular Formula | C16H17FN4O5 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-N'-(4-fluoro-3-nitrophenyl)oxamide |
| SMILES | CN(C)[C@@H](CNC(=O)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1)c1ccco1 |
| InChI | InChI=1S/C16H17FN4O5/c1-20(2)13(14-4-3-7-26-14)9-18-15(22)16(23)19-10-5-6-11(17)12(8-10)21(24)25/h3-8,13H,9H2,1-2H3,(H,18,22)(H,19,23)/t13-/m0/s1 |
| InChIKey | ZVJGWZGFAZPIQJ-ZDUSSCGKSA-N |
| XLogP | 1.68 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|