C16H21FN4O4S — CID 74238570
1-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[2-fluoro-5-(methanesulfonamido)phenyl]urea (PubChem CID 74238570) has the molecular formula C16H21FN4O4S and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[2-fluoro-5-(methanesulfonamido)phenyl]urea.
| Compound Name | 1-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[2-fluoro-5-(methanesulfonamido)phenyl]urea |
|---|---|
| PubChem CID | 74238570 |
| Molecular Formula | C16H21FN4O4S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[2-fluoro-5-(methanesulfonamido)phenyl]urea |
| SMILES | CN(C)C(CNC(=O)Nc1cc(NS(C)(=O)=O)ccc1F)c1ccco1 |
| InChI | InChI=1S/C16H21FN4O4S/c1-21(2)14(15-5-4-8-25-15)10-18-16(22)19-13-9-11(6-7-12(13)17)20-26(3,23)24/h4-9,14,20H,10H2,1-3H3,(H2,18,19,22) |
| InChIKey | LZALRFFBJDQMRT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |