C15H15FN2O5 — CID 78879195
methyl 4-fluoro-3-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]benzoate (PubChem CID 78879195) has the molecular formula C15H15FN2O5 and a molecular weight of 322.29 g/mol. Its IUPAC name is methyl 4-fluoro-3-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]benzoate.
| Compound Name | methyl 4-fluoro-3-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 78879195 |
| Molecular Formula | C15H15FN2O5 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | methyl 4-fluoro-3-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccc(F)c(NC(=O)NCC(O)c2ccco2)c1 |
| InChI | InChI=1S/C15H15FN2O5/c1-22-14(20)9-4-5-10(16)11(7-9)18-15(21)17-8-12(19)13-3-2-6-23-13/h2-7,12,19H,8H2,1H3,(H2,17,18,21) |
| InChIKey | MAFXMNDOKKBNGU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |