C13H18ClFN2O3 — CID 119702256
methyl 4-fluoro-3-[[2-methyl-3-(methylamino)propanoyl]amino]benzoate;hydrochloride (PubChem CID 119702256) has the molecular formula C13H18ClFN2O3 and a molecular weight of 304.75 g/mol. Its IUPAC name is methyl 4-fluoro-3-[[2-methyl-3-(methylamino)propanoyl]amino]benzoate;hydrochloride.
| Compound Name | methyl 4-fluoro-3-[[2-methyl-3-(methylamino)propanoyl]amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119702256 |
| Molecular Formula | C13H18ClFN2O3 |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | methyl 4-fluoro-3-[[2-methyl-3-(methylamino)propanoyl]amino]benzoate;hydrochloride |
| SMILES | CNCC(C)C(=O)Nc1cc(C(=O)OC)ccc1F.Cl |
| InChI | InChI=1S/C13H17FN2O3.ClH/c1-8(7-15-2)12(17)16-11-6-9(13(18)19-3)4-5-10(11)14;/h4-6,8,15H,7H2,1-3H3,(H,16,17);1H |
| InChIKey | BYNRXFNXAVSNAH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |