C14H19FN2O3 — CID 43703145
methyl 3-[(2-amino-3-methylpentanoyl)amino]-4-fluorobenzoate (PubChem CID 43703145) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is methyl 3-[(2-amino-3-methylpentanoyl)amino]-4-fluorobenzoate.
| Compound Name | methyl 3-[(2-amino-3-methylpentanoyl)amino]-4-fluorobenzoate |
|---|---|
| PubChem CID | 43703145 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | methyl 3-[(2-amino-3-methylpentanoyl)amino]-4-fluorobenzoate |
| SMILES | CCC(C)C(N)C(=O)Nc1cc(C(=O)OC)ccc1F |
| InChI | InChI=1S/C14H19FN2O3/c1-4-8(2)12(16)13(18)17-11-7-9(14(19)20-3)5-6-10(11)15/h5-8,12H,4,16H2,1-3H3,(H,17,18) |
| InChIKey | TYEJSXPTAHPBIQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |