C14H19FN2O3 — CID 61179435
methyl 3-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-4-fluorobenzoate (PubChem CID 61179435) has the molecular formula C14H19FN2O3 and a molecular weight of 282.32 g/mol. Its IUPAC name is methyl 3-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-4-fluorobenzoate.
| Compound Name | methyl 3-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-4-fluorobenzoate |
|---|---|
| PubChem CID | 61179435 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | methyl 3-[[(2S)-2-amino-3,3-dimethylbutanoyl]amino]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(NC(=O)[C@@H](N)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H19FN2O3/c1-14(2,3)11(16)12(18)17-10-7-8(13(19)20-4)5-6-9(10)15/h5-7,11H,16H2,1-4H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | BMLLZXGEQQNPSX-LLVKDONJSA-N |
| XLogP | 1.92 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |