C14H20FN3O2 — CID 76893268
N-(5-acetamido-2-fluorophenyl)-2-amino-3,3-dimethylbutanamide (PubChem CID 76893268) has the molecular formula C14H20FN3O2 and a molecular weight of 281.33 g/mol. Its IUPAC name is N-(5-acetamido-2-fluorophenyl)-2-amino-3,3-dimethylbutanamide.
| Compound Name | N-(5-acetamido-2-fluorophenyl)-2-amino-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 76893268 |
| Molecular Formula | C14H20FN3O2 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-(5-acetamido-2-fluorophenyl)-2-amino-3,3-dimethylbutanamide |
| SMILES | CC(=O)Nc1ccc(F)c(NC(=O)C(N)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H20FN3O2/c1-8(19)17-9-5-6-10(15)11(7-9)18-13(20)12(16)14(2,3)4/h5-7,12H,16H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | SDYIVVAEUOIGTC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |