C13H17FN2O3 — CID 60843122
methyl 4-fluoro-3-[4-(methylamino)butanoylamino]benzoate (PubChem CID 60843122) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is methyl 4-fluoro-3-[4-(methylamino)butanoylamino]benzoate.
| Compound Name | methyl 4-fluoro-3-[4-(methylamino)butanoylamino]benzoate |
|---|---|
| PubChem CID | 60843122 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | methyl 4-fluoro-3-[4-(methylamino)butanoylamino]benzoate |
| SMILES | CNCCCC(=O)Nc1cc(C(=O)OC)ccc1F |
| InChI | InChI=1S/C13H17FN2O3/c1-15-7-3-4-12(17)16-11-8-9(13(18)19-2)5-6-10(11)14/h5-6,8,15H,3-4,7H2,1-2H3,(H,16,17) |
| InChIKey | QKUIIVRCJDMDRV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|