C13H17FN2O4 — CID 79281167
methyl 4-fluoro-3-[[2-(2-methoxyethylamino)acetyl]amino]benzoate (PubChem CID 79281167) has the molecular formula C13H17FN2O4 and a molecular weight of 284.29 g/mol. Its IUPAC name is methyl 4-fluoro-3-[[2-(2-methoxyethylamino)acetyl]amino]benzoate.
| Compound Name | methyl 4-fluoro-3-[[2-(2-methoxyethylamino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 79281167 |
| Molecular Formula | C13H17FN2O4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | methyl 4-fluoro-3-[[2-(2-methoxyethylamino)acetyl]amino]benzoate |
| SMILES | COCCNCC(=O)Nc1cc(C(=O)OC)ccc1F |
| InChI | InChI=1S/C13H17FN2O4/c1-19-6-5-15-8-12(17)16-11-7-9(13(18)20-2)3-4-10(11)14/h3-4,7,15H,5-6,8H2,1-2H3,(H,16,17) |
| InChIKey | FYPHBEIDHKJYDA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|