C13H19ClFN3O3 — CID 119705055
N-(5-acetamido-2-fluorophenyl)-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119705055) has the molecular formula C13H19ClFN3O3 and a molecular weight of 319.76 g/mol. Its IUPAC name is N-(5-acetamido-2-fluorophenyl)-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-(5-acetamido-2-fluorophenyl)-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119705055 |
| Molecular Formula | C13H19ClFN3O3 |
| Molecular Weight | 319.76 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-(5-acetamido-2-fluorophenyl)-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1cc(NC(C)=O)ccc1F.Cl |
| InChI | InChI=1S/C13H18FN3O3.ClH/c1-9(18)16-10-3-4-11(14)12(7-10)17-13(19)8-15-5-6-20-2;/h3-4,7,15H,5-6,8H2,1-2H3,(H,16,18)(H,17,19);1H |
| InChIKey | OUKBZWQGUPMOBA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.76 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|