C16H22ClFN4O2 — CID 119731550
N-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119731550) has the molecular formula C16H22ClFN4O2 and a molecular weight of 356.83 g/mol. Its IUPAC name is N-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119731550 |
| Molecular Formula | C16H22ClFN4O2 |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-[4-(3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1ccc(-n2nc(C)cc2C)c(F)c1.Cl |
| InChI | InChI=1S/C16H21FN4O2.ClH/c1-11-8-12(2)21(20-11)15-5-4-13(9-14(15)17)19-16(22)10-18-6-7-23-3;/h4-5,8-9,18H,6-7,10H2,1-3H3,(H,19,22);1H |
| InChIKey | ZKPVHDSWYISAQV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|