C17H16F2N2O3 — CID 17454893
methyl 3-[[2-(2,5-difluoroanilino)-2-oxoethyl]amino]-4-methylbenzoate (PubChem CID 17454893) has the molecular formula C17H16F2N2O3 and a molecular weight of 334.32 g/mol. Its IUPAC name is methyl 3-[[2-(2,5-difluoroanilino)-2-oxoethyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-(2,5-difluoroanilino)-2-oxoethyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 17454893 |
| Molecular Formula | C17H16F2N2O3 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | methyl 3-[[2-(2,5-difluoroanilino)-2-oxoethyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NCC(=O)Nc2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C17H16F2N2O3/c1-10-3-4-11(17(23)24-2)7-14(10)20-9-16(22)21-15-8-12(18)5-6-13(15)19/h3-8,20H,9H2,1-2H3,(H,21,22) |
| InChIKey | VBHRLIVLOXSSPX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |