C16H14FIN2O3 — CID 31418792
methyl 4-fluoro-3-[[2-(2-iodoanilino)-2-oxoethyl]amino]benzoate (PubChem CID 31418792) has the molecular formula C16H14FIN2O3 and a molecular weight of 428.20 g/mol. Its IUPAC name is methyl 4-fluoro-3-[[2-(2-iodoanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | methyl 4-fluoro-3-[[2-(2-iodoanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 31418792 |
| Molecular Formula | C16H14FIN2O3 |
| Molecular Weight | 428.20 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | methyl 4-fluoro-3-[[2-(2-iodoanilino)-2-oxoethyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(F)c(NCC(=O)Nc2ccccc2I)c1 |
| InChI | InChI=1S/C16H14FIN2O3/c1-23-16(22)10-6-7-11(17)14(8-10)19-9-15(21)20-13-5-3-2-4-12(13)18/h2-8,19H,9H2,1H3,(H,20,21) |
| InChIKey | UTUASNDAFYHPAX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.20 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|