C17H21FN2O3 — CID 86922278
methyl 3-[[2-(dicyclopropylmethylamino)-2-oxoethyl]amino]-4-fluorobenzoate (PubChem CID 86922278) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is methyl 3-[[2-(dicyclopropylmethylamino)-2-oxoethyl]amino]-4-fluorobenzoate.
| Compound Name | methyl 3-[[2-(dicyclopropylmethylamino)-2-oxoethyl]amino]-4-fluorobenzoate |
|---|---|
| PubChem CID | 86922278 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | methyl 3-[[2-(dicyclopropylmethylamino)-2-oxoethyl]amino]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(NCC(=O)NC(C2CC2)C2CC2)c1 |
| InChI | InChI=1S/C17H21FN2O3/c1-23-17(22)12-6-7-13(18)14(8-12)19-9-15(21)20-16(10-2-3-10)11-4-5-11/h6-8,10-11,16,19H,2-5,9H2,1H3,(H,20,21) |
| InChIKey | HFORDAOJSFCEKB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |