C16H13ClF2N2O3 — CID 109010264
methyl 4-chloro-3-[[2-(2,6-difluoroanilino)acetyl]amino]benzoate (PubChem CID 109010264) has the molecular formula C16H13ClF2N2O3 and a molecular weight of 354.74 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(2,6-difluoroanilino)acetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(2,6-difluoroanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 109010264 |
| Molecular Formula | C16H13ClF2N2O3 |
| Molecular Weight | 354.74 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | methyl 4-chloro-3-[[2-(2,6-difluoroanilino)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CNc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C16H13ClF2N2O3/c1-24-16(23)9-5-6-10(17)13(7-9)21-14(22)8-20-15-11(18)3-2-4-12(15)19/h2-7,20H,8H2,1H3,(H,21,22) |
| InChIKey | TWFRKVQUZVKJPQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |