C20H23ClN2O3 — CID 109008060
methyl 4-chloro-3-[[2-(2,6-diethylanilino)-2-oxoethyl]amino]benzoate (PubChem CID 109008060) has the molecular formula C20H23ClN2O3 and a molecular weight of 374.87 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(2,6-diethylanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(2,6-diethylanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 109008060 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | methyl 4-chloro-3-[[2-(2,6-diethylanilino)-2-oxoethyl]amino]benzoate |
| SMILES | CCc1cccc(CC)c1NC(=O)CNc1cc(C(=O)OC)ccc1Cl |
| InChI | InChI=1S/C20H23ClN2O3/c1-4-13-7-6-8-14(5-2)19(13)23-18(24)12-22-17-11-15(20(25)26-3)9-10-16(17)21/h6-11,22H,4-5,12H2,1-3H3,(H,23,24) |
| InChIKey | DZYIXQWVLBQFPX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |