C18H19ClN2O5 — CID 109009549
methyl 4-chloro-3-[[2-(2,4-dimethoxyanilino)-2-oxoethyl]amino]benzoate (PubChem CID 109009549) has the molecular formula C18H19ClN2O5 and a molecular weight of 378.81 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(2,4-dimethoxyanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(2,4-dimethoxyanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 109009549 |
| Molecular Formula | C18H19ClN2O5 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | methyl 4-chloro-3-[[2-(2,4-dimethoxyanilino)-2-oxoethyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NCC(=O)Nc2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C18H19ClN2O5/c1-24-12-5-7-14(16(9-12)25-2)21-17(22)10-20-15-8-11(18(23)26-3)4-6-13(15)19/h4-9,20H,10H2,1-3H3,(H,21,22) |
| InChIKey | LWBHYODVHVBCOX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |