methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate

C17H17ClN2O4 — CID 109009016

IUPACmethyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate
SMILESCOC(=O)c1ccc(Cl)c(NC(=O)CNc2ccccc2OC)c1
InChIInChI=1S/C17H17ClN2O4/c1-23-15-6-4-3-5-13(15)19-10-16(21)20-14-9-11(17(22)24-2)7-8-12(14)18/h3-9,19H,10H2,1-2H3,(H,20,21)
InChIKeyGUBFKWOXTQFMKZ-UHFFFAOYSA-N
MW348.79 g/mol
LogP3.19
Rot. Bonds6

About methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate

methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate (PubChem CID 109009016) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate.

Molecular Properties

Compound Namemethyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate
PubChem CID109009016
Molecular FormulaC17H17ClN2O4
Molecular Weight348.79 g/mol
Exact Mass348.09
IUPAC Namemethyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate
SMILESCOC(=O)c1ccc(Cl)c(NC(=O)CNc2ccccc2OC)c1
InChIInChI=1S/C17H17ClN2O4/c1-23-15-6-4-3-5-13(15)19-10-16(21)20-14-9-11(17(22)24-2)7-8-12(14)18/h3-9,19H,10H2,1-2H3,(H,20,21)
InChIKeyGUBFKWOXTQFMKZ-UHFFFAOYSA-N
XLogP3.19
TPSA76.66 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500348.79
LogP ≤ 53.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate?
The IUPAC name of methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate (CID 109009016) is methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate.
What is the SMILES notation for methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate?
The canonical SMILES for methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate is COC(=O)c1ccc(Cl)c(NC(=O)CNc2ccccc2OC)c1.
What is the InChIKey of methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate?
The InChIKey is GUBFKWOXTQFMKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN2O4/c1-23-15-6-4-3-5-13(15)19-10-16(21)20-14-9-11(17(22)24-2)7-8-12(14)18/h3-9,19H,10H2,1-2H3,(H,20,21).
What are the key properties of methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate?
methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate has a molecular weight of 348.79 g/mol, XLogP of 3.19, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-chloro-3-[[2-(2-methoxyanilino)acetyl]amino]benzoate is sourced from PubChem (CID 109009016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).