C19H21ClN2O4 — CID 40919288
methyl 4-chloro-3-[[2-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]acetyl]amino]benzoate (PubChem CID 40919288) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]acetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 40919288 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | methyl 4-chloro-3-[[2-[[(1S)-1-(2-methoxyphenyl)ethyl]amino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CN[C@@H](C)c2ccccc2OC)c1 |
| InChI | InChI=1S/C19H21ClN2O4/c1-12(14-6-4-5-7-17(14)25-2)21-11-18(23)22-16-10-13(19(24)26-3)8-9-15(16)20/h4-10,12,21H,11H2,1-3H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | JXUCSPFLNLSWMD-LBPRGKRZSA-N |
| XLogP | 3.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |