C18H16ClFN2O4 — CID 113000016
methyl 4-chloro-3-[[2-[[2-(4-fluorophenyl)acetyl]amino]acetyl]amino]benzoate (PubChem CID 113000016) has the molecular formula C18H16ClFN2O4 and a molecular weight of 378.79 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-[[2-(4-fluorophenyl)acetyl]amino]acetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-[[2-(4-fluorophenyl)acetyl]amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 113000016 |
| Molecular Formula | C18H16ClFN2O4 |
| Molecular Weight | 378.79 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | methyl 4-chloro-3-[[2-[[2-(4-fluorophenyl)acetyl]amino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CNC(=O)Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H16ClFN2O4/c1-26-18(25)12-4-7-14(19)15(9-12)22-17(24)10-21-16(23)8-11-2-5-13(20)6-3-11/h2-7,9H,8,10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | ZSIJWKMNXFLXON-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |