C18H18ClFN2O3 — CID 109000570
methyl 4-chloro-3-[[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]amino]benzoate (PubChem CID 109000570) has the molecular formula C18H18ClFN2O3 and a molecular weight of 364.80 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 109000570 |
| Molecular Formula | C18H18ClFN2O3 |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | methyl 4-chloro-3-[[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NCC(=O)NCCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H18ClFN2O3/c1-25-18(24)13-4-7-15(19)16(10-13)22-11-17(23)21-9-8-12-2-5-14(20)6-3-12/h2-7,10,22H,8-9,11H2,1H3,(H,21,23) |
| InChIKey | MEHSHAIFSIGTDU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |