C14H17ClN2O4 — CID 112999994
methyl 3-[[2-(butanoylamino)acetyl]amino]-4-chlorobenzoate (PubChem CID 112999994) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is methyl 3-[[2-(butanoylamino)acetyl]amino]-4-chlorobenzoate.
| Compound Name | methyl 3-[[2-(butanoylamino)acetyl]amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 112999994 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | methyl 3-[[2-(butanoylamino)acetyl]amino]-4-chlorobenzoate |
| SMILES | CCCC(=O)NCC(=O)Nc1cc(C(=O)OC)ccc1Cl |
| InChI | InChI=1S/C14H17ClN2O4/c1-3-4-12(18)16-8-13(19)17-11-7-9(14(20)21-2)5-6-10(11)15/h5-7H,3-4,8H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | WJQGAIJMYDDLAR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |