C16H17ClN4O3 — CID 113049521
methyl 3-[[6-(butanoylamino)pyridazin-3-yl]amino]-4-chlorobenzoate (PubChem CID 113049521) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is methyl 3-[[6-(butanoylamino)pyridazin-3-yl]amino]-4-chlorobenzoate.
| Compound Name | methyl 3-[[6-(butanoylamino)pyridazin-3-yl]amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 113049521 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | methyl 3-[[6-(butanoylamino)pyridazin-3-yl]amino]-4-chlorobenzoate |
| SMILES | CCCC(=O)Nc1ccc(Nc2cc(C(=O)OC)ccc2Cl)nn1 |
| InChI | InChI=1S/C16H17ClN4O3/c1-3-4-15(22)19-14-8-7-13(20-21-14)18-12-9-10(16(23)24-2)5-6-11(12)17/h5-9H,3-4H2,1-2H3,(H,18,20)(H,19,21,22) |
| InChIKey | MAXAKEBAFXWOPC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |