C18H19ClN4O3 — CID 109112404
methyl 4-chloro-3-[[6-(cyclopentylcarbamoyl)pyridazin-3-yl]amino]benzoate (PubChem CID 109112404) has the molecular formula C18H19ClN4O3 and a molecular weight of 374.83 g/mol. Its IUPAC name is methyl 4-chloro-3-[[6-(cyclopentylcarbamoyl)pyridazin-3-yl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[6-(cyclopentylcarbamoyl)pyridazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 109112404 |
| Molecular Formula | C18H19ClN4O3 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | methyl 4-chloro-3-[[6-(cyclopentylcarbamoyl)pyridazin-3-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(Nc2ccc(C(=O)NC3CCCC3)nn2)c1 |
| InChI | InChI=1S/C18H19ClN4O3/c1-26-18(25)11-6-7-13(19)15(10-11)21-16-9-8-14(22-23-16)17(24)20-12-4-2-3-5-12/h6-10,12H,2-5H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | HHLRMUGKSOMFTQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |