C20H17ClN4O3 — CID 113049534
methyl 4-chloro-3-[[6-[(3-methylbenzoyl)amino]pyridazin-3-yl]amino]benzoate (PubChem CID 113049534) has the molecular formula C20H17ClN4O3 and a molecular weight of 396.83 g/mol. Its IUPAC name is methyl 4-chloro-3-[[6-[(3-methylbenzoyl)amino]pyridazin-3-yl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[6-[(3-methylbenzoyl)amino]pyridazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 113049534 |
| Molecular Formula | C20H17ClN4O3 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | methyl 4-chloro-3-[[6-[(3-methylbenzoyl)amino]pyridazin-3-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(Nc2ccc(NC(=O)c3cccc(C)c3)nn2)c1 |
| InChI | InChI=1S/C20H17ClN4O3/c1-12-4-3-5-13(10-12)19(26)23-18-9-8-17(24-25-18)22-16-11-14(20(27)28-2)6-7-15(16)21/h3-11H,1-2H3,(H,22,24)(H,23,25,26) |
| InChIKey | DQSZADMEDBOSFI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |