methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate

C16H14Cl2N2O3 — CID 9083030

IUPACmethyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate
SMILESCOC(=O)c1ccc(NCC(=O)Nc2cc(Cl)ccc2Cl)cc1
InChIInChI=1S/C16H14Cl2N2O3/c1-23-16(22)10-2-5-12(6-3-10)19-9-15(21)20-14-8-11(17)4-7-13(14)18/h2-8,19H,9H2,1H3,(H,20,21)
InChIKeyRZRWJUHDVQXGLU-UHFFFAOYSA-N
MW353.21 g/mol
LogP3.83
Rot. Bonds5

About methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate

methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate (PubChem CID 9083030) has the molecular formula C16H14Cl2N2O3 and a molecular weight of 353.21 g/mol. Its IUPAC name is methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate.

Molecular Properties

Compound Namemethyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate
PubChem CID9083030
Molecular FormulaC16H14Cl2N2O3
Molecular Weight353.21 g/mol
Exact Mass352.04
IUPAC Namemethyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate
SMILESCOC(=O)c1ccc(NCC(=O)Nc2cc(Cl)ccc2Cl)cc1
InChIInChI=1S/C16H14Cl2N2O3/c1-23-16(22)10-2-5-12(6-3-10)19-9-15(21)20-14-8-11(17)4-7-13(14)18/h2-8,19H,9H2,1H3,(H,20,21)
InChIKeyRZRWJUHDVQXGLU-UHFFFAOYSA-N
XLogP3.83
TPSA67.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500353.21
LogP ≤ 53.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate?
The IUPAC name of methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate (CID 9083030) is methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate.
What is the SMILES notation for methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate?
The canonical SMILES for methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate is COC(=O)c1ccc(NCC(=O)Nc2cc(Cl)ccc2Cl)cc1.
What is the InChIKey of methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate?
The InChIKey is RZRWJUHDVQXGLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2N2O3/c1-23-16(22)10-2-5-12(6-3-10)19-9-15(21)20-14-8-11(17)4-7-13(14)18/h2-8,19H,9H2,1H3,(H,20,21).
What are the key properties of methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate?
methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate has a molecular weight of 353.21 g/mol, XLogP of 3.83, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-(2,5-dichloroanilino)-2-oxoethyl]amino]benzoate is sourced from PubChem (CID 9083030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).