C16H15ClN2O3 — CID 9083102
methyl 4-[[2-(4-chloroanilino)-2-oxoethyl]amino]benzoate (PubChem CID 9083102) has the molecular formula C16H15ClN2O3 and a molecular weight of 318.76 g/mol. Its IUPAC name is methyl 4-[[2-(4-chloroanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(4-chloroanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 9083102 |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | methyl 4-[[2-(4-chloroanilino)-2-oxoethyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NCC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H15ClN2O3/c1-22-16(21)11-2-6-13(7-3-11)18-10-15(20)19-14-8-4-12(17)5-9-14/h2-9,18H,10H2,1H3,(H,19,20) |
| InChIKey | HUWKHEHPEHOQNE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |