C20H21Cl2N3O2 — CID 54841411
N-(2,5-dichlorophenyl)-2-[4-(piperidine-1-carbonyl)anilino]acetamide (PubChem CID 54841411) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[4-(piperidine-1-carbonyl)anilino]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[4-(piperidine-1-carbonyl)anilino]acetamide |
|---|---|
| PubChem CID | 54841411 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[4-(piperidine-1-carbonyl)anilino]acetamide |
| SMILES | O=C(CNc1ccc(C(=O)N2CCCCC2)cc1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H21Cl2N3O2/c21-15-6-9-17(22)18(12-15)24-19(26)13-23-16-7-4-14(5-8-16)20(27)25-10-2-1-3-11-25/h4-9,12,23H,1-3,10-11,13H2,(H,24,26) |
| InChIKey | RHPSMPYLDZYYBG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |