C23H27ClN4O3 — CID 54834192
N-[4-chloro-3-[[2-[4-(pyrrolidine-1-carbonyl)anilino]acetyl]amino]phenyl]butanamide (PubChem CID 54834192) has the molecular formula C23H27ClN4O3 and a molecular weight of 442.95 g/mol. Its IUPAC name is N-[4-chloro-3-[[2-[4-(pyrrolidine-1-carbonyl)anilino]acetyl]amino]phenyl]butanamide.
| Compound Name | N-[4-chloro-3-[[2-[4-(pyrrolidine-1-carbonyl)anilino]acetyl]amino]phenyl]butanamide |
|---|---|
| PubChem CID | 54834192 |
| Molecular Formula | C23H27ClN4O3 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-[4-chloro-3-[[2-[4-(pyrrolidine-1-carbonyl)anilino]acetyl]amino]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=O)CNc2ccc(C(=O)N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C23H27ClN4O3/c1-2-5-21(29)26-18-10-11-19(24)20(14-18)27-22(30)15-25-17-8-6-16(7-9-17)23(31)28-12-3-4-13-28/h6-11,14,25H,2-5,12-13,15H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | LBMOEXWAMLEAOY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |