C23H29ClN4O3 — CID 54831817
N-[4-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]phenyl]-3-methylbutanamide (PubChem CID 54831817) has the molecular formula C23H29ClN4O3 and a molecular weight of 444.96 g/mol. Its IUPAC name is N-[4-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]phenyl]-3-methylbutanamide.
| Compound Name | N-[4-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 54831817 |
| Molecular Formula | C23H29ClN4O3 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[4-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]phenyl]-3-methylbutanamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=O)CNc2ccc(NC(=O)CC(C)C)cc2)c1 |
| InChI | InChI=1S/C23H29ClN4O3/c1-4-5-21(29)27-18-10-11-19(24)20(13-18)28-23(31)14-25-16-6-8-17(9-7-16)26-22(30)12-15(2)3/h6-11,13,15,25H,4-5,12,14H2,1-3H3,(H,26,30)(H,27,29)(H,28,31) |
| InChIKey | JDONCWPRNNSHAI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |