C23H29ClN4O3 — CID 54834442
4-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]-N-tert-butylbenzamide (PubChem CID 54834442) has the molecular formula C23H29ClN4O3 and a molecular weight of 444.96 g/mol. Its IUPAC name is 4-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]-N-tert-butylbenzamide.
| Compound Name | 4-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]-N-tert-butylbenzamide |
|---|---|
| PubChem CID | 54834442 |
| Molecular Formula | C23H29ClN4O3 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 4-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]-N-tert-butylbenzamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=O)CNc2ccc(C(=O)NC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C23H29ClN4O3/c1-5-6-20(29)26-17-11-12-18(24)19(13-17)27-21(30)14-25-16-9-7-15(8-10-16)22(31)28-23(2,3)4/h7-13,25H,5-6,14H2,1-4H3,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | KTTRIORWAJBEEY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |