C27H29ClN4O3 — CID 54838462
4-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]-N-ethyl-N-phenylbenzamide (PubChem CID 54838462) has the molecular formula C27H29ClN4O3 and a molecular weight of 493.01 g/mol. Its IUPAC name is 4-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]-N-ethyl-N-phenylbenzamide.
| Compound Name | 4-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]-N-ethyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 54838462 |
| Molecular Formula | C27H29ClN4O3 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 4-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]-N-ethyl-N-phenylbenzamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=O)CNc2ccc(C(=O)N(CC)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H29ClN4O3/c1-3-8-25(33)30-21-15-16-23(28)24(17-21)31-26(34)18-29-20-13-11-19(12-14-20)27(35)32(4-2)22-9-6-5-7-10-22/h5-7,9-17,29H,3-4,8,18H2,1-2H3,(H,30,33)(H,31,34) |
| InChIKey | GKLSTYKLBRPCCO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |