C24H22F3N3O2 — CID 54838383
N-ethyl-4-[[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]amino]-N-phenylbenzamide (PubChem CID 54838383) has the molecular formula C24H22F3N3O2 and a molecular weight of 441.45 g/mol. Its IUPAC name is N-ethyl-4-[[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]amino]-N-phenylbenzamide.
| Compound Name | N-ethyl-4-[[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 54838383 |
| Molecular Formula | C24H22F3N3O2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-ethyl-4-[[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]amino]-N-phenylbenzamide |
| SMILES | CCN(C(=O)c1ccc(NCC(=O)Nc2cccc(C(F)(F)F)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H22F3N3O2/c1-2-30(21-9-4-3-5-10-21)23(32)17-11-13-19(14-12-17)28-16-22(31)29-20-8-6-7-18(15-20)24(25,26)27/h3-15,28H,2,16H2,1H3,(H,29,31) |
| InChIKey | PMBOMRQFFBZVBU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |