C19H22F3N3O — CID 109009742
N-[4-(diethylamino)phenyl]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 109009742) has the molecular formula C19H22F3N3O and a molecular weight of 365.40 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[4-(diethylamino)phenyl]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 109009742 |
| Molecular Formula | C19H22F3N3O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CNc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H22F3N3O/c1-3-25(4-2)17-10-8-15(9-11-17)24-18(26)13-23-16-7-5-6-14(12-16)19(20,21)22/h5-12,23H,3-4,13H2,1-2H3,(H,24,26) |
| InChIKey | GIQYDMQUBZHYGW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|