C15H11F5N2O — CID 7409925
N-(3,4-difluorophenyl)-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 7409925) has the molecular formula C15H11F5N2O and a molecular weight of 330.26 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 7409925 |
| Molecular Formula | C15H11F5N2O |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C(F)(F)F)c1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H11F5N2O/c16-12-5-4-11(7-13(12)17)22-14(23)8-21-10-3-1-2-9(6-10)15(18,19)20/h1-7,21H,8H2,(H,22,23) |
| InChIKey | VCHNBBPNNRZBAD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |