C21H25F3N2O2 — CID 54833824
N-(4-hexoxyphenyl)-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 54833824) has the molecular formula C21H25F3N2O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is N-(4-hexoxyphenyl)-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-(4-hexoxyphenyl)-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 54833824 |
| Molecular Formula | C21H25F3N2O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-(4-hexoxyphenyl)-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | CCCCCCOc1ccc(NC(=O)CNc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H25F3N2O2/c1-2-3-4-5-13-28-19-11-9-17(10-12-19)26-20(27)15-25-18-8-6-7-16(14-18)21(22,23)24/h6-12,14,25H,2-5,13,15H2,1H3,(H,26,27) |
| InChIKey | LECYIJQONSDFMC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|