C22H27F3N2O2 — CID 54821633
2-(4-heptoxyanilino)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 54821633) has the molecular formula C22H27F3N2O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-(4-heptoxyanilino)-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4-heptoxyanilino)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 54821633 |
| Molecular Formula | C22H27F3N2O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-(4-heptoxyanilino)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCCCCCCOc1ccc(NCC(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H27F3N2O2/c1-2-3-4-5-6-14-29-20-12-10-18(11-13-20)26-16-21(28)27-19-9-7-8-17(15-19)22(23,24)25/h7-13,15,26H,2-6,14,16H2,1H3,(H,27,28) |
| InChIKey | GAFHVKRBKHTQFQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|