C29H32F3N3O3 — CID 54844272
3-[[2-(4-heptoxyanilino)-2-oxoethyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 54844272) has the molecular formula C29H32F3N3O3 and a molecular weight of 527.59 g/mol. Its IUPAC name is 3-[[2-(4-heptoxyanilino)-2-oxoethyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[[2-(4-heptoxyanilino)-2-oxoethyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 54844272 |
| Molecular Formula | C29H32F3N3O3 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 3-[[2-(4-heptoxyanilino)-2-oxoethyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCCCCCCOc1ccc(NC(=O)CNc2cccc(C(=O)Nc3cccc(C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C29H32F3N3O3/c1-2-3-4-5-6-17-38-26-15-13-23(14-16-26)34-27(36)20-33-24-11-7-9-21(18-24)28(37)35-25-12-8-10-22(19-25)29(30,31)32/h7-16,18-19,33H,2-6,17,20H2,1H3,(H,34,36)(H,35,37) |
| InChIKey | ADGSDMPVALIOCS-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|