C30H26F3N3O4 — CID 54844347
3-[[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 54844347) has the molecular formula C30H26F3N3O4 and a molecular weight of 549.55 g/mol. Its IUPAC name is 3-[[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 54844347 |
| Molecular Formula | C30H26F3N3O4 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 3-[[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]amino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(CNc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1)Nc1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C30H26F3N3O4/c31-30(32,33)22-7-5-9-25(19-22)36-29(38)21-6-4-8-24(18-21)34-20-28(37)35-23-12-14-27(15-13-23)40-17-16-39-26-10-2-1-3-11-26/h1-15,18-19,34H,16-17,20H2,(H,35,37)(H,36,38) |
| InChIKey | BQFPPDBARNXJNT-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|