C20H23F3N4O — CID 2353577
N-[[4-(diethylamino)phenyl]methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 2353577) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 2353577 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)CNc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H23F3N4O/c1-3-27(4-2)18-10-8-15(9-11-18)13-25-26-19(28)14-24-17-7-5-6-16(12-17)20(21,22)23/h5-13,24H,3-4,14H2,1-2H3,(H,26,28) |
| InChIKey | QZACHCUDXZOGJJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|