C27H29N3O4 — CID 54812803
propyl 4-[[2-[4-[ethyl(phenyl)carbamoyl]anilino]-2-oxoethyl]amino]benzoate (PubChem CID 54812803) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is propyl 4-[[2-[4-[ethyl(phenyl)carbamoyl]anilino]-2-oxoethyl]amino]benzoate.
| Compound Name | propyl 4-[[2-[4-[ethyl(phenyl)carbamoyl]anilino]-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 54812803 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | propyl 4-[[2-[4-[ethyl(phenyl)carbamoyl]anilino]-2-oxoethyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NCC(=O)Nc2ccc(C(=O)N(CC)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H29N3O4/c1-3-18-34-27(33)21-12-14-22(15-13-21)28-19-25(31)29-23-16-10-20(11-17-23)26(32)30(4-2)24-8-6-5-7-9-24/h5-17,28H,3-4,18-19H2,1-2H3,(H,29,31) |
| InChIKey | VYSIUALXFVUAGA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |