C28H32N4O3 — CID 54834536
N-tert-butyl-4-[[2-[4-[ethyl(phenyl)carbamoyl]anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54834536) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-tert-butyl-4-[[2-[4-[ethyl(phenyl)carbamoyl]anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-tert-butyl-4-[[2-[4-[ethyl(phenyl)carbamoyl]anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54834536 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-tert-butyl-4-[[2-[4-[ethyl(phenyl)carbamoyl]anilino]-2-oxoethyl]amino]benzamide |
| SMILES | CCN(C(=O)c1ccc(NC(=O)CNc2ccc(C(=O)NC(C)(C)C)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H32N4O3/c1-5-32(24-9-7-6-8-10-24)27(35)21-13-17-23(18-14-21)30-25(33)19-29-22-15-11-20(12-16-22)26(34)31-28(2,3)4/h6-18,29H,5,19H2,1-4H3,(H,30,33)(H,31,34) |
| InChIKey | SVZADYHYILQAJX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |