C26H27ClN4O3 — CID 54837359
3-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide (PubChem CID 54837359) has the molecular formula C26H27ClN4O3 and a molecular weight of 478.98 g/mol. Its IUPAC name is 3-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide.
| Compound Name | 3-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 54837359 |
| Molecular Formula | C26H27ClN4O3 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 3-[[2-[5-(butanoylamino)-2-chloroanilino]-2-oxoethyl]amino]-N-methyl-N-phenylbenzamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=O)CNc2cccc(C(=O)N(C)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C26H27ClN4O3/c1-3-8-24(32)29-20-13-14-22(27)23(16-20)30-25(33)17-28-19-10-7-9-18(15-19)26(34)31(2)21-11-5-4-6-12-21/h4-7,9-16,28H,3,8,17H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | AUWGBICOUDLMMX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |