C22H19Cl2N3O2 — CID 54813421
3-[[2-(3,5-dichloroanilino)acetyl]amino]-N-methyl-N-phenylbenzamide (PubChem CID 54813421) has the molecular formula C22H19Cl2N3O2 and a molecular weight of 428.32 g/mol. Its IUPAC name is 3-[[2-(3,5-dichloroanilino)acetyl]amino]-N-methyl-N-phenylbenzamide.
| Compound Name | 3-[[2-(3,5-dichloroanilino)acetyl]amino]-N-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 54813421 |
| Molecular Formula | C22H19Cl2N3O2 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 3-[[2-(3,5-dichloroanilino)acetyl]amino]-N-methyl-N-phenylbenzamide |
| SMILES | CN(C(=O)c1cccc(NC(=O)CNc2cc(Cl)cc(Cl)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H19Cl2N3O2/c1-27(20-8-3-2-4-9-20)22(29)15-6-5-7-18(10-15)26-21(28)14-25-19-12-16(23)11-17(24)13-19/h2-13,25H,14H2,1H3,(H,26,28) |
| InChIKey | IFTIYPQJJCVOLJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |