C18H17Cl2N3OS — CID 17300379
1-(2,5-dichlorophenyl)-3-[4-(pyrrolidine-1-carbonyl)phenyl]thiourea (PubChem CID 17300379) has the molecular formula C18H17Cl2N3OS and a molecular weight of 394.33 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[4-(pyrrolidine-1-carbonyl)phenyl]thiourea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[4-(pyrrolidine-1-carbonyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17300379 |
| Molecular Formula | C18H17Cl2N3OS |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[4-(pyrrolidine-1-carbonyl)phenyl]thiourea |
| SMILES | O=C(c1ccc(NC(=S)Nc2cc(Cl)ccc2Cl)cc1)N1CCCC1 |
| InChI | InChI=1S/C18H17Cl2N3OS/c19-13-5-8-15(20)16(11-13)22-18(25)21-14-6-3-12(4-7-14)17(24)23-9-1-2-10-23/h3-8,11H,1-2,9-10H2,(H2,21,22,25) |
| InChIKey | PZQIPWFOXQGGLQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|