C18H16Cl2N2O3 — CID 109045546
N-(2,5-dichlorophenyl)-4-(morpholine-4-carbonyl)benzamide (PubChem CID 109045546) has the molecular formula C18H16Cl2N2O3 and a molecular weight of 379.24 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-(morpholine-4-carbonyl)benzamide.
| Compound Name | N-(2,5-dichlorophenyl)-4-(morpholine-4-carbonyl)benzamide |
|---|---|
| PubChem CID | 109045546 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-(morpholine-4-carbonyl)benzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)c1ccc(C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O3/c19-14-5-6-15(20)16(11-14)21-17(23)12-1-3-13(4-2-12)18(24)22-7-9-25-10-8-22/h1-6,11H,7-10H2,(H,21,23) |
| InChIKey | AEUOJOBYUPZBGZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |