C19H17Cl2N3O3S — CID 54860189
3-chloro-N-[[2-chloro-5-(morpholine-4-carbonyl)phenyl]carbamothioyl]benzamide (PubChem CID 54860189) has the molecular formula C19H17Cl2N3O3S and a molecular weight of 438.34 g/mol. Its IUPAC name is 3-chloro-N-[[2-chloro-5-(morpholine-4-carbonyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-chloro-N-[[2-chloro-5-(morpholine-4-carbonyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 54860189 |
| Molecular Formula | C19H17Cl2N3O3S |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 3-chloro-N-[[2-chloro-5-(morpholine-4-carbonyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cc(C(=O)N2CCOCC2)ccc1Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2N3O3S/c20-14-3-1-2-12(10-14)17(25)23-19(28)22-16-11-13(4-5-15(16)21)18(26)24-6-8-27-9-7-24/h1-5,10-11H,6-9H2,(H2,22,23,25,28) |
| InChIKey | IKTJZGVUWHOXFX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|