C22H23Cl2N3O4S — CID 54860166
2-(2-chloro-4,6-dimethylphenoxy)-N-[[2-chloro-5-(morpholine-4-carbonyl)phenyl]carbamothioyl]acetamide (PubChem CID 54860166) has the molecular formula C22H23Cl2N3O4S and a molecular weight of 496.42 g/mol. Its IUPAC name is 2-(2-chloro-4,6-dimethylphenoxy)-N-[[2-chloro-5-(morpholine-4-carbonyl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(2-chloro-4,6-dimethylphenoxy)-N-[[2-chloro-5-(morpholine-4-carbonyl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 54860166 |
| Molecular Formula | C22H23Cl2N3O4S |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 2-(2-chloro-4,6-dimethylphenoxy)-N-[[2-chloro-5-(morpholine-4-carbonyl)phenyl]carbamothioyl]acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)NC(=S)Nc2cc(C(=O)N3CCOCC3)ccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H23Cl2N3O4S/c1-13-9-14(2)20(17(24)10-13)31-12-19(28)26-22(32)25-18-11-15(3-4-16(18)23)21(29)27-5-7-30-8-6-27/h3-4,9-11H,5-8,12H2,1-2H3,(H2,25,26,28,32) |
| InChIKey | MPIJXPWPJSDPHU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|