C20H20ClN3O4S — CID 54860110
N-[[2-chloro-5-(morpholine-4-carbonyl)phenyl]carbamothioyl]-3-methoxybenzamide (PubChem CID 54860110) has the molecular formula C20H20ClN3O4S and a molecular weight of 433.92 g/mol. Its IUPAC name is N-[[2-chloro-5-(morpholine-4-carbonyl)phenyl]carbamothioyl]-3-methoxybenzamide.
| Compound Name | N-[[2-chloro-5-(morpholine-4-carbonyl)phenyl]carbamothioyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 54860110 |
| Molecular Formula | C20H20ClN3O4S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-[[2-chloro-5-(morpholine-4-carbonyl)phenyl]carbamothioyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC(=S)Nc2cc(C(=O)N3CCOCC3)ccc2Cl)c1 |
| InChI | InChI=1S/C20H20ClN3O4S/c1-27-15-4-2-3-13(11-15)18(25)23-20(29)22-17-12-14(5-6-16(17)21)19(26)24-7-9-28-10-8-24/h2-6,11-12H,7-10H2,1H3,(H2,22,23,25,29) |
| InChIKey | OPJSCZAVUGNCDQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|